C28H32N2O2S — CID 159310622
N-benzylformamide;2-imino-1-(4-phenylsulfanylphenyl)octan-1-one (PubChem CID 159310622) has the molecular formula C28H32N2O2S and a molecular weight of 460.64 g/mol. Its IUPAC name is N-benzylformamide;2-imino-1-(4-phenylsulfanylphenyl)octan-1-one.
| Compound Name | N-benzylformamide;2-imino-1-(4-phenylsulfanylphenyl)octan-1-one |
|---|---|
| PubChem CID | 159310622 |
| Molecular Formula | C28H32N2O2S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N-benzylformamide;2-imino-1-(4-phenylsulfanylphenyl)octan-1-one |
| SMILES | O=CNCc1ccccc1.[H]/N=C(\CCCCCC)C(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NOS.C8H9NO/c1-2-3-4-8-11-19(21)20(22)16-12-14-18(15-13-16)23-17-9-6-5-7-10-17;10-7-9-6-8-4-2-1-3-5-8/h5-7,9-10,12-15,21H,2-4,8,11H2,1H3;1-5,7H,6H2,(H,9,10)/b21-19+; |
| InChIKey | LCMLAXNTJYSAOI-UXJRWBAGSA-N |
| XLogP | 6.94 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|