C57H39F3N6 — CID 159339093
2-[4-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 159339093) has the molecular formula C57H39F3N6 and a molecular weight of 864.98 g/mol. Its IUPAC name is 2-[4-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 159339093 |
| Molecular Formula | C57H39F3N6 |
| Molecular Weight | 864.98 g/mol |
| Exact Mass | 864.32 |
| IUPAC Name | 2-[4-[4-[2-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC(c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)cc1)(c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C57H39F3N6/c1-56(57(58,59)60,48-34-30-40(31-35-48)38-22-26-46(27-23-38)54-63-50(42-14-6-2-7-15-42)61-51(64-54)43-16-8-3-9-17-43)49-36-32-41(33-37-49)39-24-28-47(29-25-39)55-65-52(44-18-10-4-11-19-44)62-53(66-55)45-20-12-5-13-21-45/h2-37H,1H3 |
| InChIKey | KZRGZNLMRSJODV-UHFFFAOYSA-N |
| XLogP | 14.26 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.98 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |