C16H25NO2 — CID 159348037
(Z)-N-[(2R,3R,6R)-2,5-dimethyl-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl]-4-methylpent-2-enamide (PubChem CID 159348037) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (Z)-N-[(2R,3R,6R)-2,5-dimethyl-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl]-4-methylpent-2-enamide.
| Compound Name | (Z)-N-[(2R,3R,6R)-2,5-dimethyl-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 159348037 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (Z)-N-[(2R,3R,6R)-2,5-dimethyl-6-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl]-4-methylpent-2-enamide |
| SMILES | C=CC[C@H]1O[C@H](C)[C@H](NC(=O)/C=C\C(C)C)C=C1C |
| InChI | InChI=1S/C16H25NO2/c1-6-7-15-12(4)10-14(13(5)19-15)17-16(18)9-8-11(2)3/h6,8-11,13-15H,1,7H2,2-5H3,(H,17,18)/b9-8-/t13-,14-,15-/m1/s1 |
| InChIKey | LGYXTHDMACUPRW-RKNRVPRMSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|