C20H32N2O5 — CID 138539414
(2S)-2-[(E)-5-[[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]amino]-5-oxopent-3-en-2-yl]morpholine-4-carboxylic acid (PubChem CID 138539414) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is (2S)-2-[(E)-5-[[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]amino]-5-oxopent-3-en-2-yl]morpholine-4-carboxylic acid.
| Compound Name | (2S)-2-[(E)-5-[[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]amino]-5-oxopent-3-en-2-yl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 138539414 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (2S)-2-[(E)-5-[[(2R,3R,5S,6S)-2,5-dimethyl-6-prop-2-enyloxan-3-yl]amino]-5-oxopent-3-en-2-yl]morpholine-4-carboxylic acid |
| SMILES | C=CC[C@@H]1O[C@H](C)[C@H](NC(=O)/C=C/C(C)[C@H]2CN(C(=O)O)CCO2)C[C@@H]1C |
| InChI | InChI=1S/C20H32N2O5/c1-5-6-17-14(3)11-16(15(4)27-17)21-19(23)8-7-13(2)18-12-22(20(24)25)9-10-26-18/h5,7-8,13-18H,1,6,9-12H2,2-4H3,(H,21,23)(H,24,25)/b8-7+/t13?,14-,15+,16+,17-,18+/m0/s1 |
| InChIKey | OEJSBABKAMJZAF-IWYIMFSUSA-N |
| XLogP | 2.43 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|