C32H46Cl2N2O8S3 — CID 159349017
tert-butyl N-(3-hydroxy-1-thiophen-3-ylpropyl)carbamate;dichloromethane;[3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropyl] 4-methylbenzenesulfonate (PubChem CID 159349017) has the molecular formula C32H46Cl2N2O8S3 and a molecular weight of 753.83 g/mol. Its IUPAC name is tert-butyl N-(3-hydroxy-1-thiophen-3-ylpropyl)carbamate;dichloromethane;[3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropyl] 4-methylbenzenesulfonate.
| Compound Name | tert-butyl N-(3-hydroxy-1-thiophen-3-ylpropyl)carbamate;dichloromethane;[3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159349017 |
| Molecular Formula | C32H46Cl2N2O8S3 |
| Molecular Weight | 753.83 g/mol |
| Exact Mass | 752.18 |
| IUPAC Name | tert-butyl N-(3-hydroxy-1-thiophen-3-ylpropyl)carbamate;dichloromethane;[3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-3-ylpropyl] 4-methylbenzenesulfonate |
| SMILES | CC(C)(C)OC(=O)NC(CCO)c1ccsc1.Cc1ccc(S(=O)(=O)OCCC(NC(=O)OC(C)(C)C)c2ccsc2)cc1.ClCCl |
| InChI | InChI=1S/C19H25NO5S2.C12H19NO3S.CH2Cl2/c1-14-5-7-16(8-6-14)27(22,23)24-11-9-17(15-10-12-26-13-15)20-18(21)25-19(2,3)4;1-12(2,3)16-11(15)13-10(4-6-14)9-5-7-17-8-9;2-1-3/h5-8,10,12-13,17H,9,11H2,1-4H3,(H,20,21);5,7-8,10,14H,4,6H2,1-3H3,(H,13,15);1H2 |
| InChIKey | LHCBHIXXYJKQIL-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.83 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|