C19H25NO4S2 — CID 134611241
[3-(2,2-dimethylpropanoylamino)-3-thiophen-3-ylpropyl] 4-methylbenzenesulfonate (PubChem CID 134611241) has the molecular formula C19H25NO4S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoylamino)-3-thiophen-3-ylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [3-(2,2-dimethylpropanoylamino)-3-thiophen-3-ylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134611241 |
| Molecular Formula | C19H25NO4S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [3-(2,2-dimethylpropanoylamino)-3-thiophen-3-ylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(NC(=O)C(C)(C)C)c2ccsc2)cc1 |
| InChI | InChI=1S/C19H25NO4S2/c1-14-5-7-16(8-6-14)26(22,23)24-11-9-17(15-10-12-25-13-15)20-18(21)19(2,3)4/h5-8,10,12-13,17H,9,11H2,1-4H3,(H,20,21) |
| InChIKey | QAZPCHLEISSSTK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|