C27H18F9NO4 — CID 159350327
3-[2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoethyl]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide (PubChem CID 159350327) has the molecular formula C27H18F9NO4 and a molecular weight of 591.43 g/mol. Its IUPAC name is 3-[2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoethyl]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide.
| Compound Name | 3-[2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoethyl]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide |
|---|---|
| PubChem CID | 159350327 |
| Molecular Formula | C27H18F9NO4 |
| Molecular Weight | 591.43 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 3-[2-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-oxoethyl]-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]benzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1cccc(CC(=O)c2ccc3c(c2)OC(F)(F)O3)c1 |
| InChI | InChI=1S/C27H18F9NO4/c1-13-8-18(24(28,25(29,30)31)26(32,33)34)9-14(2)22(13)37-23(39)17-5-3-4-15(10-17)11-19(38)16-6-7-20-21(12-16)41-27(35,36)40-20/h3-10,12H,11H2,1-2H3,(H,37,39) |
| InChIKey | WGELILJPOCIUMR-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.43 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |