C45H57N7O2 — CID 159417936
2-(4-butoxyphenyl)-5-(4-methylpiperazin-1-yl)-3H-indole;3-[4-[5-(4-methylpiperazin-1-yl)-3H-indol-2-yl]phenoxy]propan-1-amine (PubChem CID 159417936) has the molecular formula C45H57N7O2 and a molecular weight of 728.00 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-5-(4-methylpiperazin-1-yl)-3H-indole;3-[4-[5-(4-methylpiperazin-1-yl)-3H-indol-2-yl]phenoxy]propan-1-amine.
| Compound Name | 2-(4-butoxyphenyl)-5-(4-methylpiperazin-1-yl)-3H-indole;3-[4-[5-(4-methylpiperazin-1-yl)-3H-indol-2-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 159417936 |
| Molecular Formula | C45H57N7O2 |
| Molecular Weight | 728.00 g/mol |
| Exact Mass | 727.46 |
| IUPAC Name | 2-(4-butoxyphenyl)-5-(4-methylpiperazin-1-yl)-3H-indole;3-[4-[5-(4-methylpiperazin-1-yl)-3H-indol-2-yl]phenoxy]propan-1-amine |
| SMILES | CCCCOc1ccc(C2=Nc3ccc(N4CCN(C)CC4)cc3C2)cc1.CN1CCN(c2ccc3c(c2)CC(c2ccc(OCCCN)cc2)=N3)CC1 |
| InChI | InChI=1S/C23H29N3O.C22H28N4O/c1-3-4-15-27-21-8-5-18(6-9-21)23-17-19-16-20(7-10-22(19)24-23)26-13-11-25(2)12-14-26;1-25-10-12-26(13-11-25)19-5-8-21-18(15-19)16-22(24-21)17-3-6-20(7-4-17)27-14-2-9-23/h5-10,16H,3-4,11-15,17H2,1-2H3;3-8,15H,2,9-14,16,23H2,1H3 |
| InChIKey | LPKAOVVPQGKUEC-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.00 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|