About diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone
diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone (PubChem CID 159479843) has the molecular formula C29H29N3O2
and a molecular weight of 451.57 g/mol. Its IUPAC name is diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone.
Molecular Properties
| Compound Name | diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone |
| PubChem CID | 159479843 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone |
| SMILES | CNc1cc(NC)c(C(=O)c2ccccc2)c(NC)c1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O.C13H10O/c1-17-12-9-13(18-2)15(14(10-12)19-3)16(20)11-7-5-4-6-8-11;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h4-10,17-19H,1-3H3;1-10H |
| InChIKey | LWWAXLJAFVAXHV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone?
The IUPAC name of diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone (CID 159479843) is diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone.
What is the SMILES notation for diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone?
The canonical SMILES for diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone is CNc1cc(NC)c(C(=O)c2ccccc2)c(NC)c1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone?
The InChIKey is LWWAXLJAFVAXHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O.C13H10O/c1-17-12-9-13(18-2)15(14(10-12)19-3)16(20)11-7-5-4-6-8-11;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h4-10,17-19H,1-3H3;1-10H.
What are the key properties of diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone?
diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone has a molecular weight of 451.57 g/mol, XLogP of 5.96, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;phenyl-[2,4,6-tris(methylamino)phenyl]methanone is sourced from PubChem (CID 159479843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).