C48H55NO4Si — CID 15948544
(2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,7-trimethyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonine-9-carboxamide (PubChem CID 15948544) has the molecular formula C48H55NO4Si and a molecular weight of 738.06 g/mol. Its IUPAC name is (2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,7-trimethyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonine-9-carboxamide.
| Compound Name | (2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,7-trimethyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonine-9-carboxamide |
|---|---|
| PubChem CID | 15948544 |
| Molecular Formula | C48H55NO4Si |
| Molecular Weight | 738.06 g/mol |
| Exact Mass | 737.39 |
| IUPAC Name | (2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-N,N,7-trimethyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonine-9-carboxamide |
| SMILES | C/C1=C\CC[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](C(=O)N(C)C)C1 |
| InChI | InChI=1S/C48H55NO4Si/c1-37-23-22-34-43(53-48(38-24-12-7-13-25-38,39-26-14-8-15-27-39)40-28-16-9-17-29-40)45(52-44(35-37)46(50)49(5)6)36-51-54(47(2,3)4,41-30-18-10-19-31-41)42-32-20-11-21-33-42/h7-21,23-33,43-45H,22,34-36H2,1-6H3/b37-23+/t43-,44-,45-/m1/s1 |
| InChIKey | KFONGZWAQXVQGI-YLAKQDEYSA-N |
| XLogP | 8.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.06 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|