C16H22O2S — CID 159535156
sulfur dioxide;(3S,4S,5R)-1,4,5-trimethyl-3-phenylcycloheptene (PubChem CID 159535156) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is sulfur dioxide;(3S,4S,5R)-1,4,5-trimethyl-3-phenylcycloheptene.
| Compound Name | sulfur dioxide;(3S,4S,5R)-1,4,5-trimethyl-3-phenylcycloheptene |
|---|---|
| PubChem CID | 159535156 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | sulfur dioxide;(3S,4S,5R)-1,4,5-trimethyl-3-phenylcycloheptene |
| SMILES | CC1=C[C@@H](c2ccccc2)[C@@H](C)[C@H](C)CC1.O=S=O |
| InChI | InChI=1S/C16H22.O2S/c1-12-9-10-13(2)14(3)16(11-12)15-7-5-4-6-8-15;1-3-2/h4-8,11,13-14,16H,9-10H2,1-3H3;/t13-,14+,16-;/m1./s1 |
| InChIKey | MDMMOKFJCYTSEK-CFDZSLPFSA-N |
| XLogP | 4.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|