C18H27NO5 — CID 159548088
[2-[2-amino-4-(hydroxymethyl)-6-methylphenoxy]-4,5,6-trimethyloxan-3-yl] acetate (PubChem CID 159548088) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is [2-[2-amino-4-(hydroxymethyl)-6-methylphenoxy]-4,5,6-trimethyloxan-3-yl] acetate.
| Compound Name | [2-[2-amino-4-(hydroxymethyl)-6-methylphenoxy]-4,5,6-trimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 159548088 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [2-[2-amino-4-(hydroxymethyl)-6-methylphenoxy]-4,5,6-trimethyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(Oc2c(C)cc(CO)cc2N)OC(C)C(C)C1C |
| InChI | InChI=1S/C18H27NO5/c1-9-6-14(8-20)7-15(19)16(9)24-18-17(23-13(5)21)11(3)10(2)12(4)22-18/h6-7,10-12,17-18,20H,8,19H2,1-5H3 |
| InChIKey | APBXISYPUKGVKJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|