C44H56N4O10S — CID 159570608
(2,5-dioxopyrrolidin-1-yl) 4-[8-[3-[4-[[(8-anilino-8-oxooctanoyl)amino]oxymethyl]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]-3-oxooctyl]cyclohexane-1-carboxylate (PubChem CID 159570608) has the molecular formula C44H56N4O10S and a molecular weight of 833.02 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[8-[3-[4-[[(8-anilino-8-oxooctanoyl)amino]oxymethyl]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]-3-oxooctyl]cyclohexane-1-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[8-[3-[4-[[(8-anilino-8-oxooctanoyl)amino]oxymethyl]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]-3-oxooctyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 159570608 |
| Molecular Formula | C44H56N4O10S |
| Molecular Weight | 833.02 g/mol |
| Exact Mass | 832.37 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[8-[3-[4-[[(8-anilino-8-oxooctanoyl)amino]oxymethyl]phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]-3-oxooctyl]cyclohexane-1-carboxylate |
| SMILES | O=C(CCCCCN1C(=O)CC(Sc2ccc(CONC(=O)CCCCCCC(=O)Nc3ccccc3)cc2)C1=O)CCC1CCC(C(=O)ON2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C44H56N4O10S/c49-35(23-18-31-16-21-33(22-17-31)44(56)58-48-40(52)26-27-41(48)53)13-7-4-10-28-47-42(54)29-37(43(47)55)59-36-24-19-32(20-25-36)30-57-46-39(51)15-9-2-1-8-14-38(50)45-34-11-5-3-6-12-34/h3,5-6,11-12,19-20,24-25,31,33,37H,1-2,4,7-10,13-18,21-23,26-30H2,(H,45,50)(H,46,51) |
| InChIKey | RZYXEGPSNKSGRH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 185.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.02 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|