C11H26N2O4S — CID 159595183
N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide (PubChem CID 159595183) has the molecular formula C11H26N2O4S and a molecular weight of 282.41 g/mol. Its IUPAC name is N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide.
| Compound Name | N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 159595183 |
| Molecular Formula | C11H26N2O4S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide |
| SMILES | CC(C)S(=O)(=O)N(C)C.CON(C)C(=O)C(C)C |
| InChI | InChI=1S/C6H13NO2.C5H13NO2S/c1-5(2)6(8)7(3)9-4;1-5(2)9(7,8)6(3)4/h2*5H,1-4H3 |
| InChIKey | MKSZZNBEEYTOJR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|