About N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide
N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide (PubChem CID 159595183) has the molecular formula C11H26N2O4S
and a molecular weight of 282.41 g/mol. Its IUPAC name is N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide |
| PubChem CID | 159595183 |
| Molecular Formula | C11H26N2O4S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide |
| SMILES | CC(C)S(=O)(=O)N(C)C.CON(C)C(=O)C(C)C |
| InChI | InChI=1S/C6H13NO2.C5H13NO2S/c1-5(2)6(8)7(3)9-4;1-5(2)9(7,8)6(3)4/h2*5H,1-4H3 |
| InChIKey | MKSZZNBEEYTOJR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide?
The IUPAC name of N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide (CID 159595183) is N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide.
What is the SMILES notation for N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide?
The canonical SMILES for N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide is CC(C)S(=O)(=O)N(C)C.CON(C)C(=O)C(C)C.
What is the InChIKey of N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide?
The InChIKey is MKSZZNBEEYTOJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2.C5H13NO2S/c1-5(2)6(8)7(3)9-4;1-5(2)9(7,8)6(3)4/h2*5H,1-4H3.
What are the key properties of N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide?
N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide has a molecular weight of 282.41 g/mol, XLogP of 0.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpropane-2-sulfonamide;N-methoxy-N,2-dimethylpropanamide is sourced from PubChem (CID 159595183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).