C12H9O9Ru — CID 159597762
cyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylate;ruthenium(3+) (PubChem CID 159597762) has the molecular formula C12H9O9Ru and a molecular weight of 398.27 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylate;ruthenium(3+).
| Compound Name | cyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylate;ruthenium(3+) |
|---|---|
| PubChem CID | 159597762 |
| Molecular Formula | C12H9O9Ru |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;2-hydroxypropane-1,2,3-tricarboxylate;ruthenium(3+) |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].O=C1C=CC(=O)C=C1.[Ru+3] |
| InChI | InChI=1S/C6H8O7.C6H4O2.Ru/c7-3(8)1-6(13,5(11)12)2-4(9)10;7-5-1-2-6(8)4-3-5;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-4H;/q;;+3/p-3 |
| InChIKey | MLBNQJPSFOZXNF-UHFFFAOYSA-K |
| XLogP | -5.00 |
| TPSA | 174.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | -5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|