C28H28F4O4S2 — CID 159610964
[4-(2-bicyclo[2.2.1]heptanyloxy)phenyl]-diphenylsulfanium;1,1,2,2-tetrafluoropropane-1-sulfonate (PubChem CID 159610964) has the molecular formula C28H28F4O4S2 and a molecular weight of 568.65 g/mol. Its IUPAC name is [4-(2-bicyclo[2.2.1]heptanyloxy)phenyl]-diphenylsulfanium;1,1,2,2-tetrafluoropropane-1-sulfonate.
| Compound Name | [4-(2-bicyclo[2.2.1]heptanyloxy)phenyl]-diphenylsulfanium;1,1,2,2-tetrafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 159610964 |
| Molecular Formula | C28H28F4O4S2 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | [4-(2-bicyclo[2.2.1]heptanyloxy)phenyl]-diphenylsulfanium;1,1,2,2-tetrafluoropropane-1-sulfonate |
| SMILES | CC(F)(F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccc(OC3CC4CCC3C4)cc2)cc1 |
| InChI | InChI=1S/C25H25OS.C3H4F4O3S/c1-3-7-22(8-4-1)27(23-9-5-2-6-10-23)24-15-13-21(14-16-24)26-25-18-19-11-12-20(25)17-19;1-2(4,5)3(6,7)11(8,9)10/h1-10,13-16,19-20,25H,11-12,17-18H2;1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | MMRLICITXUARNP-UHFFFAOYSA-M |
| XLogP | 7.13 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|