C31H50 — CID 159612326
3-deuterio-2-methyl-6-methylideneocta-1,7-diene;2,3-dimethyl-6-methylideneocta-1,7-diene;7-methyl-3-methylideneocta-1,6-diene (PubChem CID 159612326) has the molecular formula C31H50 and a molecular weight of 423.75 g/mol. Its IUPAC name is 3-deuterio-2-methyl-6-methylideneocta-1,7-diene;2,3-dimethyl-6-methylideneocta-1,7-diene;7-methyl-3-methylideneocta-1,6-diene.
| Compound Name | 3-deuterio-2-methyl-6-methylideneocta-1,7-diene;2,3-dimethyl-6-methylideneocta-1,7-diene;7-methyl-3-methylideneocta-1,6-diene |
|---|---|
| PubChem CID | 159612326 |
| Molecular Formula | C31H50 |
| Molecular Weight | 423.75 g/mol |
| Exact Mass | 423.40 |
| IUPAC Name | 3-deuterio-2-methyl-6-methylideneocta-1,7-diene;2,3-dimethyl-6-methylideneocta-1,7-diene;7-methyl-3-methylideneocta-1,6-diene |
| SMILES | C=CC(=C)CCC(C)C(=C)C.C=CC(=C)CCC=C(C)C.[2H]C(CCC(=C)C=C)C(=C)C |
| InChI | InChI=1S/C11H18.2C10H16/c1-6-10(4)7-8-11(5)9(2)3;2*1-5-10(4)8-6-7-9(2)3/h6,11H,1-2,4,7-8H2,3,5H3;5,7H,1,4,6,8H2,2-3H3;5H,1-2,4,6-8H2,3H3/i;;7D |
| InChIKey | MMVVVHOOKYYPCV-VLRLUKQHSA-N |
| XLogP | 10.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.75 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|