C29H40N10O — CID 159614929
9-[5-(4-amino-6-methyl-1,3,5-triazin-2-yl)pentylamino]-N-[2-[bis(2-aminoethyl)amino]ethyl]acridine-4-carboxamide (PubChem CID 159614929) has the molecular formula C29H40N10O and a molecular weight of 544.71 g/mol. Its IUPAC name is 9-[5-(4-amino-6-methyl-1,3,5-triazin-2-yl)pentylamino]-N-[2-[bis(2-aminoethyl)amino]ethyl]acridine-4-carboxamide.
| Compound Name | 9-[5-(4-amino-6-methyl-1,3,5-triazin-2-yl)pentylamino]-N-[2-[bis(2-aminoethyl)amino]ethyl]acridine-4-carboxamide |
|---|---|
| PubChem CID | 159614929 |
| Molecular Formula | C29H40N10O |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 9-[5-(4-amino-6-methyl-1,3,5-triazin-2-yl)pentylamino]-N-[2-[bis(2-aminoethyl)amino]ethyl]acridine-4-carboxamide |
| SMILES | Cc1nc(N)nc(CCCCCNc2c3ccccc3nc3c(C(=O)NCCN(CCN)CCN)cccc23)n1 |
| InChI | InChI=1S/C29H40N10O/c1-20-35-25(38-29(32)36-20)12-3-2-6-15-33-26-21-8-4-5-11-24(21)37-27-22(26)9-7-10-23(27)28(40)34-16-19-39(17-13-30)18-14-31/h4-5,7-11H,2-3,6,12-19,30-31H2,1H3,(H,33,37)(H,34,40)(H2,32,35,36,38) |
| InChIKey | UKIYWBNNXSVKCH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 173.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|