C23H27N5O3S — CID 11577186
2-[[9-[2-[methyl(methylcarbamothioyl)amino]ethylamino]acridine-4-carbonyl]amino]ethyl acetate (PubChem CID 11577186) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-[[9-[2-[methyl(methylcarbamothioyl)amino]ethylamino]acridine-4-carbonyl]amino]ethyl acetate.
| Compound Name | 2-[[9-[2-[methyl(methylcarbamothioyl)amino]ethylamino]acridine-4-carbonyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 11577186 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[[9-[2-[methyl(methylcarbamothioyl)amino]ethylamino]acridine-4-carbonyl]amino]ethyl acetate |
| SMILES | CNC(=S)N(C)CCNc1c2ccccc2nc2c(C(=O)NCCOC(C)=O)cccc12 |
| InChI | InChI=1S/C23H27N5O3S/c1-15(29)31-14-12-26-22(30)18-9-6-8-17-20(25-11-13-28(3)23(32)24-2)16-7-4-5-10-19(16)27-21(17)18/h4-10H,11-14H2,1-3H3,(H,24,32)(H,25,27)(H,26,30) |
| InChIKey | YAWYCJOHRSGFNR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|