C28H32N8O5S — CID 11714094
9-[2-[methyl(methylcarbamothioyl)amino]ethylamino]-N-[2-(phenylcarbamoylamino)ethyl]acridine-4-carboxamide;nitric acid (PubChem CID 11714094) has the molecular formula C28H32N8O5S and a molecular weight of 592.68 g/mol. Its IUPAC name is 9-[2-[methyl(methylcarbamothioyl)amino]ethylamino]-N-[2-(phenylcarbamoylamino)ethyl]acridine-4-carboxamide;nitric acid.
| Compound Name | 9-[2-[methyl(methylcarbamothioyl)amino]ethylamino]-N-[2-(phenylcarbamoylamino)ethyl]acridine-4-carboxamide;nitric acid |
|---|---|
| PubChem CID | 11714094 |
| Molecular Formula | C28H32N8O5S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | 9-[2-[methyl(methylcarbamothioyl)amino]ethylamino]-N-[2-(phenylcarbamoylamino)ethyl]acridine-4-carboxamide;nitric acid |
| SMILES | CNC(=S)N(C)CCNc1c2ccccc2nc2c(C(=O)NCCNC(=O)Nc3ccccc3)cccc12.O=[N+]([O-])O |
| InChI | InChI=1S/C28H31N7O2S.HNO3/c1-29-28(38)35(2)18-17-30-24-20-11-6-7-14-23(20)34-25-21(24)12-8-13-22(25)26(36)31-15-16-32-27(37)33-19-9-4-3-5-10-19;2-1(3)4/h3-14H,15-18H2,1-2H3,(H,29,38)(H,30,34)(H,31,36)(H2,32,33,37);(H,2,3,4) |
| InChIKey | HJTMNPCQJIEDTB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 173.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|