C62H84N4O12 — CID 159630702
2,2-bis[3-(N-ethylanilino)propanoyloxymethyl]butyl 3-(N-ethylanilino)propanoate;2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;N-ethylaniline (PubChem CID 159630702) has the molecular formula C62H84N4O12 and a molecular weight of 1077.37 g/mol. Its IUPAC name is 2,2-bis[3-(N-ethylanilino)propanoyloxymethyl]butyl 3-(N-ethylanilino)propanoate;2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;N-ethylaniline.
| Compound Name | 2,2-bis[3-(N-ethylanilino)propanoyloxymethyl]butyl 3-(N-ethylanilino)propanoate;2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;N-ethylaniline |
|---|---|
| PubChem CID | 159630702 |
| Molecular Formula | C62H84N4O12 |
| Molecular Weight | 1077.37 g/mol |
| Exact Mass | 1076.61 |
| IUPAC Name | 2,2-bis[3-(N-ethylanilino)propanoyloxymethyl]butyl 3-(N-ethylanilino)propanoate;2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;N-ethylaniline |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C.CCN(CCC(=O)OCC(CC)(COC(=O)CCN(CC)c1ccccc1)COC(=O)CCN(CC)c1ccccc1)c1ccccc1.CCNc1ccccc1 |
| InChI | InChI=1S/C39H53N3O6.C15H20O6.C8H11N/c1-5-39(30-46-36(43)24-27-40(6-2)33-18-12-9-13-19-33,31-47-37(44)25-28-41(7-3)34-20-14-10-15-21-34)32-48-38(45)26-29-42(8-4)35-22-16-11-17-23-35;1-5-12(16)19-9-15(8-4,10-20-13(17)6-2)11-21-14(18)7-3;1-2-9-8-6-4-3-5-7-8/h9-23H,5-8,24-32H2,1-4H3;5-7H,1-3,8-11H2,4H3;3-7,9H,2H2,1H3 |
| InChIKey | MPBWZYLGMFYDBA-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 179.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1077.37 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|