C13H22O — CID 15965983
(2E)-3-tert-butyl-6,6-dimethylhepta-2,4-dienal (PubChem CID 15965983) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (2E)-3-tert-butyl-6,6-dimethylhepta-2,4-dienal.
| Compound Name | (2E)-3-tert-butyl-6,6-dimethylhepta-2,4-dienal |
|---|---|
| PubChem CID | 15965983 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (2E)-3-tert-butyl-6,6-dimethylhepta-2,4-dienal |
| SMILES | CC(C)(C)C=C/C(=C\C=O)C(C)(C)C |
| InChI | InChI=1S/C13H22O/c1-12(2,3)9-7-11(8-10-14)13(4,5)6/h7-10H,1-6H3/b9-7?,11-8+ |
| InChIKey | LMGQRLRSBCBIOR-USAYTYELSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|