C40H32F6N6O6S2 — CID 159696781
N-(2-aminophenyl)benzenesulfonamide;1-[2-(benzenesulfonamido)phenyl]-3-[4-(trifluoromethyl)phenyl]urea;1-isocyanato-4-(trifluoromethyl)benzene (PubChem CID 159696781) has the molecular formula C40H32F6N6O6S2 and a molecular weight of 870.85 g/mol. Its IUPAC name is N-(2-aminophenyl)benzenesulfonamide;1-[2-(benzenesulfonamido)phenyl]-3-[4-(trifluoromethyl)phenyl]urea;1-isocyanato-4-(trifluoromethyl)benzene.
| Compound Name | N-(2-aminophenyl)benzenesulfonamide;1-[2-(benzenesulfonamido)phenyl]-3-[4-(trifluoromethyl)phenyl]urea;1-isocyanato-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 159696781 |
| Molecular Formula | C40H32F6N6O6S2 |
| Molecular Weight | 870.85 g/mol |
| Exact Mass | 870.17 |
| IUPAC Name | N-(2-aminophenyl)benzenesulfonamide;1-[2-(benzenesulfonamido)phenyl]-3-[4-(trifluoromethyl)phenyl]urea;1-isocyanato-4-(trifluoromethyl)benzene |
| SMILES | Nc1ccccc1NS(=O)(=O)c1ccccc1.O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ccccc1NS(=O)(=O)c1ccccc1.O=C=Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3N3O3S.C12H12N2O2S.C8H4F3NO/c21-20(22,23)14-10-12-15(13-11-14)24-19(27)25-17-8-4-5-9-18(17)26-30(28,29)16-6-2-1-3-7-16;13-11-8-4-5-9-12(11)14-17(15,16)10-6-2-1-3-7-10;9-8(10,11)6-1-3-7(4-2-6)12-5-13/h1-13,26H,(H2,24,25,27);1-9,14H,13H2;1-4H |
| InChIKey | MXCMMGNVUOWSIW-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 188.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.85 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|