About 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol
2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol (PubChem CID 159710411) has the molecular formula C12H8Cl2F2S2
and a molecular weight of 325.23 g/mol. Its IUPAC name is 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol.
Molecular Properties
| Compound Name | 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol |
| PubChem CID | 159710411 |
| Molecular Formula | C12H8Cl2F2S2 |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol |
| SMILES | Fc1cccc(F)c1S.Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C6H4Cl2S.C6H4F2S/c7-4-1-2-6(9)5(8)3-4;7-4-2-1-3-5(8)6(4)9/h2*1-3,9H |
| InChIKey | MYTLKXHHONWZSV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol?
The IUPAC name of 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol (CID 159710411) is 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol.
What is the SMILES notation for 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol?
The canonical SMILES for 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol is Fc1cccc(F)c1S.Sc1ccc(Cl)cc1Cl.
What is the InChIKey of 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol?
The InChIKey is MYTLKXHHONWZSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2S.C6H4F2S/c7-4-1-2-6(9)5(8)3-4;7-4-2-1-3-5(8)6(4)9/h2*1-3,9H.
What are the key properties of 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol?
2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol has a molecular weight of 325.23 g/mol, XLogP of 5.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorobenzenethiol;2,6-difluorobenzenethiol is sourced from PubChem (CID 159710411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).