C18H18N2O5SY — CID 159714639
4-[[(Z)-2-[1-(2-oxopropyl)pyridin-1-ium-4-yl]but-2-enoyl]amino]benzenesulfonate;yttrium (PubChem CID 159714639) has the molecular formula C18H18N2O5SY and a molecular weight of 463.32 g/mol. Its IUPAC name is 4-[[(Z)-2-[1-(2-oxopropyl)pyridin-1-ium-4-yl]but-2-enoyl]amino]benzenesulfonate;yttrium.
| Compound Name | 4-[[(Z)-2-[1-(2-oxopropyl)pyridin-1-ium-4-yl]but-2-enoyl]amino]benzenesulfonate;yttrium |
|---|---|
| PubChem CID | 159714639 |
| Molecular Formula | C18H18N2O5SY |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 4-[[(Z)-2-[1-(2-oxopropyl)pyridin-1-ium-4-yl]but-2-enoyl]amino]benzenesulfonate;yttrium |
| SMILES | C/C=C(\C(=O)Nc1ccc(S(=O)(=O)[O-])cc1)c1cc[n+](CC(C)=O)cc1.[Y] |
| InChI | InChI=1S/C18H18N2O5S.Y/c1-3-17(14-8-10-20(11-9-14)12-13(2)21)18(22)19-15-4-6-16(7-5-15)26(23,24)25;/h3-11H,12H2,1-2H3,(H-,19,22,23,24,25);/b17-3-; |
| InChIKey | DFLUABLWEAMTCM-UMNZIYLQSA-N |
| XLogP | 1.51 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|