C30H34ClN2PRu — CID 15975189
chlororuthenium(1+);1-[3-[(dimethylamino)methyl]benzene-5-id-1-yl]-N,N-dimethylmethanamine;triphenylphosphane (PubChem CID 15975189) has the molecular formula C30H34ClN2PRu and a molecular weight of 590.11 g/mol. Its IUPAC name is chlororuthenium(1+);1-[3-[(dimethylamino)methyl]benzene-5-id-1-yl]-N,N-dimethylmethanamine;triphenylphosphane.
| Compound Name | chlororuthenium(1+);1-[3-[(dimethylamino)methyl]benzene-5-id-1-yl]-N,N-dimethylmethanamine;triphenylphosphane |
|---|---|
| PubChem CID | 15975189 |
| Molecular Formula | C30H34ClN2PRu |
| Molecular Weight | 590.11 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | chlororuthenium(1+);1-[3-[(dimethylamino)methyl]benzene-5-id-1-yl]-N,N-dimethylmethanamine;triphenylphosphane |
| SMILES | CN(C)Cc1c[c-]cc(CN(C)C)c1.Cl[Ru+].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C12H19N2.ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-13(2)9-11-6-5-7-12(8-11)10-14(3)4;;/h1-15H;6-8H,9-10H2,1-4H3;1H;/q;-1;;+2/p-1 |
| InChIKey | AOPZMBLFNSRFMV-UHFFFAOYSA-M |
| XLogP | 5.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.11 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|