About CID 159806159
CID 159806159 (PubChem CID 159806159) has the molecular formula C4H14BN3
and a molecular weight of 114.99 g/mol.
Molecular Properties
| Compound Name | CID 159806159 |
| PubChem CID | 159806159 |
| Molecular Formula | C4H14BN3 |
| Molecular Weight | 114.99 g/mol |
| Exact Mass | 115.13 |
| IUPAC Name | — |
| SMILES | NN.[B]N(CC)CC |
| InChI | InChI=1S/C4H10BN.H4N2/c1-3-6(5)4-2;1-2/h3-4H2,1-2H3;1-2H2 |
| InChIKey | KUIVFFLBHFEBCH-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.99 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 159806159 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159806159?
The IUPAC name of CID 159806159 (CID 159806159) is not available.
What is the SMILES notation for CID 159806159?
The canonical SMILES for CID 159806159 is NN.[B]N(CC)CC.
What is the InChIKey of CID 159806159?
The InChIKey is KUIVFFLBHFEBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10BN.H4N2/c1-3-6(5)4-2;1-2/h3-4H2,1-2H3;1-2H2.
What are the key properties of CID 159806159?
CID 159806159 has a molecular weight of 114.99 g/mol, XLogP of -0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159806159 is sourced from PubChem (CID 159806159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).