About CID 145048745
CID 145048745 (PubChem CID 145048745) has the molecular formula C6H14BN
and a molecular weight of 111.00 g/mol.
Molecular Properties
| Compound Name | CID 145048745 |
| PubChem CID | 145048745 |
| Molecular Formula | C6H14BN |
| Molecular Weight | 111.00 g/mol |
| Exact Mass | 111.12 |
| IUPAC Name | — |
| SMILES | [B]N(C)CCCCC |
| InChI | InChI=1S/C6H14BN/c1-3-4-5-6-8(2)7/h3-6H2,1-2H3 |
| InChIKey | MTMADEYUNAKQRJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.00 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 145048745 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145048745?
The IUPAC name of CID 145048745 (CID 145048745) is not available.
What is the SMILES notation for CID 145048745?
The canonical SMILES for CID 145048745 is [B]N(C)CCCCC.
What is the InChIKey of CID 145048745?
The InChIKey is MTMADEYUNAKQRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14BN/c1-3-4-5-6-8(2)7/h3-6H2,1-2H3.
What are the key properties of CID 145048745?
CID 145048745 has a molecular weight of 111.00 g/mol, XLogP of 1.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145048745 is sourced from PubChem (CID 145048745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).