C26H28N4S — CID 159828087
21,22-dihydroporphyrin;1-propylsulfanylpropane (PubChem CID 159828087) has the molecular formula C26H28N4S and a molecular weight of 428.61 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;1-propylsulfanylpropane.
| Compound Name | 21,22-dihydroporphyrin;1-propylsulfanylpropane |
|---|---|
| PubChem CID | 159828087 |
| Molecular Formula | C26H28N4S |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 21,22-dihydroporphyrin;1-propylsulfanylpropane |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.CCCSCCC |
| InChI | InChI=1S/C20H14N4.C6H14S/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-3-5-7-6-4-2/h1-12,21-22H;3-6H2,1-2H3/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | BFYYXSCSFWZJJK-QDJBTJTOSA-N |
| XLogP | 7.20 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|