C40H50BN3O8 — CID 159857102
tert-butyl 3-[(2R)-5-amino-4-oxo-5-[6-(phenylmethoxycarbonylamino)-3-pyridinyl]-2-[(1S,2S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]-2-methoxybenzoate (PubChem CID 159857102) has the molecular formula C40H50BN3O8 and a molecular weight of 711.67 g/mol. Its IUPAC name is tert-butyl 3-[(2R)-5-amino-4-oxo-5-[6-(phenylmethoxycarbonylamino)-3-pyridinyl]-2-[(1S,2S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]-2-methoxybenzoate.
| Compound Name | tert-butyl 3-[(2R)-5-amino-4-oxo-5-[6-(phenylmethoxycarbonylamino)-3-pyridinyl]-2-[(1S,2S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 159857102 |
| Molecular Formula | C40H50BN3O8 |
| Molecular Weight | 711.67 g/mol |
| Exact Mass | 711.37 |
| IUPAC Name | tert-butyl 3-[(2R)-5-amino-4-oxo-5-[6-(phenylmethoxycarbonylamino)-3-pyridinyl]-2-[(1S,2S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pentyl]-2-methoxybenzoate |
| SMILES | COc1c(C[C@H](CC(=O)C(N)c2ccc(NC(=O)OCc3ccccc3)nc2)B2OC3C[C@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H50BN3O8/c1-38(2,3)50-36(46)29-15-11-14-25(35(29)48-7)18-28(41-51-32-20-27-19-31(39(27,4)5)40(32,6)52-41)21-30(45)34(42)26-16-17-33(43-22-26)44-37(47)49-23-24-12-9-8-10-13-24/h8-17,22,27-28,31-32,34H,18-21,23,42H2,1-7H3,(H,43,44,47)/t27-,28-,31+,32?,34?,40+/m1/s1 |
| InChIKey | LXRCJUPCKXMRRR-QPLFCHQGSA-N |
| XLogP | 7.09 |
| TPSA | 148.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.67 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|