C17H32F4S — CID 159925774
9-methyl-1-(4,4,5,5-tetrafluorohexylsulfanyl)decane (PubChem CID 159925774) has the molecular formula C17H32F4S and a molecular weight of 344.50 g/mol. Its IUPAC name is 9-methyl-1-(4,4,5,5-tetrafluorohexylsulfanyl)decane.
| Compound Name | 9-methyl-1-(4,4,5,5-tetrafluorohexylsulfanyl)decane |
|---|---|
| PubChem CID | 159925774 |
| Molecular Formula | C17H32F4S |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 9-methyl-1-(4,4,5,5-tetrafluorohexylsulfanyl)decane |
| SMILES | CC(C)CCCCCCCCSCCCC(F)(F)C(C)(F)F |
| InChI | InChI=1S/C17H32F4S/c1-15(2)11-8-6-4-5-7-9-13-22-14-10-12-17(20,21)16(3,18)19/h15H,4-14H2,1-3H3 |
| InChIKey | JLEKLQQARIYYBT-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|