C16H25NO3 — CID 159932884
(1S,5S)-2-(tert-butylcarbamoyl)-2-methyl-3-prop-2-enylbicyclo[3.1.0]hexane-1-carboxylic acid (PubChem CID 159932884) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (1S,5S)-2-(tert-butylcarbamoyl)-2-methyl-3-prop-2-enylbicyclo[3.1.0]hexane-1-carboxylic acid.
| Compound Name | (1S,5S)-2-(tert-butylcarbamoyl)-2-methyl-3-prop-2-enylbicyclo[3.1.0]hexane-1-carboxylic acid |
|---|---|
| PubChem CID | 159932884 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (1S,5S)-2-(tert-butylcarbamoyl)-2-methyl-3-prop-2-enylbicyclo[3.1.0]hexane-1-carboxylic acid |
| SMILES | C=CCC1C[C@H]2C[C@@]2(C(=O)O)C1(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H25NO3/c1-6-7-10-8-11-9-16(11,13(19)20)15(10,5)12(18)17-14(2,3)4/h6,10-11H,1,7-9H2,2-5H3,(H,17,18)(H,19,20)/t10?,11-,15?,16+/m0/s1 |
| InChIKey | PAQAHZPUZNJCPH-NKATULPZSA-N |
| XLogP | 2.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|