C15H27N3O2 — CID 141443834
(1S,2S,4S)-1-acetamido-4-amino-N-tert-butyl-2-prop-2-enylcyclopentane-1-carboxamide (PubChem CID 141443834) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is (1S,2S,4S)-1-acetamido-4-amino-N-tert-butyl-2-prop-2-enylcyclopentane-1-carboxamide.
| Compound Name | (1S,2S,4S)-1-acetamido-4-amino-N-tert-butyl-2-prop-2-enylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 141443834 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (1S,2S,4S)-1-acetamido-4-amino-N-tert-butyl-2-prop-2-enylcyclopentane-1-carboxamide |
| SMILES | C=CC[C@H]1C[C@H](N)C[C@@]1(NC(C)=O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H27N3O2/c1-6-7-11-8-12(16)9-15(11,17-10(2)19)13(20)18-14(3,4)5/h6,11-12H,1,7-9,16H2,2-5H3,(H,17,19)(H,18,20)/t11-,12-,15-/m0/s1 |
| InChIKey | APZZEUXZEOYXRF-HUBLWGQQSA-N |
| XLogP | 1.09 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|