About (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride
(3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride (PubChem CID 139529845) has the molecular formula C14H26ClN3O2
and a molecular weight of 303.83 g/mol. Its IUPAC name is (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride |
| PubChem CID | 139529845 |
| Molecular Formula | C14H26ClN3O2 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride |
| SMILES | C=C[C@@H]1CNC[C@@](NC(C)=O)(C(=O)NC(C)(C)C)C1.Cl |
| InChI | InChI=1S/C14H25N3O2.ClH/c1-6-11-7-14(9-15-8-11,16-10(2)18)12(19)17-13(3,4)5;/h6,11,15H,1,7-9H2,2-5H3,(H,16,18)(H,17,19);1H/t11-,14+;/m0./s1 |
| InChIKey | JPHKJSSJLPINKQ-YECZQDJWSA-N |
| XLogP | 0.99 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride?
The IUPAC name of (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride (CID 139529845) is (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride.
What is the SMILES notation for (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride?
The canonical SMILES for (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride is C=C[C@@H]1CNC[C@@](NC(C)=O)(C(=O)NC(C)(C)C)C1.Cl.
What is the InChIKey of (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride?
The InChIKey is JPHKJSSJLPINKQ-YECZQDJWSA-N. The full InChI is InChI=1S/C14H25N3O2.ClH/c1-6-11-7-14(9-15-8-11,16-10(2)18)12(19)17-13(3,4)5;/h6,11,15H,1,7-9H2,2-5H3,(H,16,18)(H,17,19);1H/t11-,14+;/m0./s1.
What are the key properties of (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride?
(3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride has a molecular weight of 303.83 g/mol, XLogP of 0.99, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride is sourced from PubChem (CID 139529845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).