C14H26ClN3O2 — CID 139529845
(3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride (PubChem CID 139529845) has the molecular formula C14H26ClN3O2 and a molecular weight of 303.83 g/mol. Its IUPAC name is (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride.
| Compound Name | (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 139529845 |
| Molecular Formula | C14H26ClN3O2 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (3R,5R)-3-acetamido-N-tert-butyl-5-ethenylpiperidine-3-carboxamide;hydrochloride |
| SMILES | C=C[C@@H]1CNC[C@@](NC(C)=O)(C(=O)NC(C)(C)C)C1.Cl |
| InChI | InChI=1S/C14H25N3O2.ClH/c1-6-11-7-14(9-15-8-11,16-10(2)18)12(19)17-13(3,4)5;/h6,11,15H,1,7-9H2,2-5H3,(H,16,18)(H,17,19);1H/t11-,14+;/m0./s1 |
| InChIKey | JPHKJSSJLPINKQ-YECZQDJWSA-N |
| XLogP | 0.99 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|