C15H28ClN3O2 — CID 139529855
(2S,3R,5R)-3-acetamido-N-tert-butyl-5-ethenyl-2-methylpiperidine-3-carboxamide;hydrochloride (PubChem CID 139529855) has the molecular formula C15H28ClN3O2 and a molecular weight of 317.86 g/mol. Its IUPAC name is (2S,3R,5R)-3-acetamido-N-tert-butyl-5-ethenyl-2-methylpiperidine-3-carboxamide;hydrochloride.
| Compound Name | (2S,3R,5R)-3-acetamido-N-tert-butyl-5-ethenyl-2-methylpiperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 139529855 |
| Molecular Formula | C15H28ClN3O2 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (2S,3R,5R)-3-acetamido-N-tert-butyl-5-ethenyl-2-methylpiperidine-3-carboxamide;hydrochloride |
| SMILES | C=C[C@@H]1CN[C@@H](C)[C@@](NC(C)=O)(C(=O)NC(C)(C)C)C1.Cl |
| InChI | InChI=1S/C15H27N3O2.ClH/c1-7-12-8-15(17-11(3)19,10(2)16-9-12)13(20)18-14(4,5)6;/h7,10,12,16H,1,8-9H2,2-6H3,(H,17,19)(H,18,20);1H/t10-,12-,15+;/m0./s1 |
| InChIKey | MVBBXANCZFSAAW-XMUWTWQESA-N |
| XLogP | 1.38 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|