C14H25NO — CID 158423097
cis-(1S,3S)-N-tert-butyl-3-ethenyl-1-methylcyclohexane-1-carboxamide (PubChem CID 158423097) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is cis-(1S,3S)-N-tert-butyl-3-ethenyl-1-methylcyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3S)-N-tert-butyl-3-ethenyl-1-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 158423097 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | cis-(1S,3S)-N-tert-butyl-3-ethenyl-1-methylcyclohexane-1-carboxamide |
| SMILES | C=C[C@H]1CCC[C@](C)(C(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C14H25NO/c1-6-11-8-7-9-14(5,10-11)12(16)15-13(2,3)4/h6,11H,1,7-10H2,2-5H3,(H,15,16)/t11-,14-/m0/s1 |
| InChIKey | HASMSISTTRUBKJ-FZMZJTMJSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|