C15H26N2O2 — CID 157241533
(1R,3R,4S)-1-acetamido-N-tert-butyl-3-ethenyl-4-methylcyclopentane-1-carboxamide (PubChem CID 157241533) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is (1R,3R,4S)-1-acetamido-N-tert-butyl-3-ethenyl-4-methylcyclopentane-1-carboxamide.
| Compound Name | (1R,3R,4S)-1-acetamido-N-tert-butyl-3-ethenyl-4-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 157241533 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (1R,3R,4S)-1-acetamido-N-tert-butyl-3-ethenyl-4-methylcyclopentane-1-carboxamide |
| SMILES | C=C[C@H]1C[C@@](NC(C)=O)(C(=O)NC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C15H26N2O2/c1-7-12-9-15(8-10(12)2,16-11(3)18)13(19)17-14(4,5)6/h7,10,12H,1,8-9H2,2-6H3,(H,16,18)(H,17,19)/t10-,12-,15+/m0/s1 |
| InChIKey | VNMGYCIKKRBTMU-ITDIGPHOSA-N |
| XLogP | 2.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|