C22H39N3O4 — CID 175211060
[2-[(1S,2R,4R)-2-acetamido-2-(tert-butylcarbamoyl)-4-ethenylcyclohexyl]-3,3-dimethylbutan-2-yl] carbamate (PubChem CID 175211060) has the molecular formula C22H39N3O4 and a molecular weight of 409.57 g/mol. Its IUPAC name is [2-[(1S,2R,4R)-2-acetamido-2-(tert-butylcarbamoyl)-4-ethenylcyclohexyl]-3,3-dimethylbutan-2-yl] carbamate.
| Compound Name | [2-[(1S,2R,4R)-2-acetamido-2-(tert-butylcarbamoyl)-4-ethenylcyclohexyl]-3,3-dimethylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 175211060 |
| Molecular Formula | C22H39N3O4 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.29 |
| IUPAC Name | [2-[(1S,2R,4R)-2-acetamido-2-(tert-butylcarbamoyl)-4-ethenylcyclohexyl]-3,3-dimethylbutan-2-yl] carbamate |
| SMILES | C=C[C@@H]1CC[C@H](C(C)(OC(N)=O)C(C)(C)C)[C@@](NC(C)=O)(C(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C22H39N3O4/c1-10-15-11-12-16(21(9,19(3,4)5)29-18(23)28)22(13-15,24-14(2)26)17(27)25-20(6,7)8/h10,15-16H,1,11-13H2,2-9H3,(H2,23,28)(H,24,26)(H,25,27)/t15-,16-,21?,22-/m1/s1 |
| InChIKey | GOLMZRLGSXXJJB-KHOJCQDMSA-N |
| XLogP | 3.28 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|