C52H68B3Br2O6 — CID 159985451
CID 159985451 (PubChem CID 159985451) has the molecular formula C52H68B3Br2O6 and a molecular weight of 981.35 g/mol.
| Compound Name | CID 159985451 |
|---|---|
| PubChem CID | 159985451 |
| Molecular Formula | C52H68B3Br2O6 |
| Molecular Weight | 981.35 g/mol |
| Exact Mass | 979.37 |
| IUPAC Name | — |
| SMILES | CC1(C)O[B]OC1(C)C.Cc1cc2c(cc1B1OC(C)(C)C(C)(C)O1)C(C)(C)c1cc(B3OC(C)(C)C(C)(C)O3)c(C)cc1-2.Cc1cc2c(cc1Br)C(C)(C)c1cc(Br)c(C)cc1-2 |
| InChI | InChI=1S/C29H40B2O4.C17H16Br2.C6H12BO2/c1-17-13-19-20-14-18(2)24(31-34-28(9,10)29(11,12)35-31)16-22(20)25(3,4)21(19)15-23(17)30-32-26(5,6)27(7,8)33-30;1-9-5-11-12-6-10(2)16(19)8-14(12)17(3,4)13(11)7-15(9)18;1-5(2)6(3,4)9-7-8-5/h13-16H,1-12H3;5-8H,1-4H3;1-4H3 |
| InChIKey | RQKONKLFENNEEH-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.35 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|