C11H16F5N — CID 160565382
1-(4,4,5,5,5-pentafluoro-2-methylpent-2-en-3-yl)piperidine (PubChem CID 160565382) has the molecular formula C11H16F5N and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-(4,4,5,5,5-pentafluoro-2-methylpent-2-en-3-yl)piperidine.
| Compound Name | 1-(4,4,5,5,5-pentafluoro-2-methylpent-2-en-3-yl)piperidine |
|---|---|
| PubChem CID | 160565382 |
| Molecular Formula | C11H16F5N |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-(4,4,5,5,5-pentafluoro-2-methylpent-2-en-3-yl)piperidine |
| SMILES | CC(C)=C(N1CCCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F5N/c1-8(2)9(10(12,13)11(14,15)16)17-6-4-3-5-7-17/h3-7H2,1-2H3 |
| InChIKey | VPZPQTMYUSQKSY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|