C22H20O5 — CID 160581120
4-methyl-2-[(Z)-2-methyl-4-(7-methylidenefuro[3,2-g]chromen-9-yl)oxybut-2-enyl]-2H-furan-5-one (PubChem CID 160581120) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-methyl-2-[(Z)-2-methyl-4-(7-methylidenefuro[3,2-g]chromen-9-yl)oxybut-2-enyl]-2H-furan-5-one.
| Compound Name | 4-methyl-2-[(Z)-2-methyl-4-(7-methylidenefuro[3,2-g]chromen-9-yl)oxybut-2-enyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 160581120 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-methyl-2-[(Z)-2-methyl-4-(7-methylidenefuro[3,2-g]chromen-9-yl)oxybut-2-enyl]-2H-furan-5-one |
| SMILES | C=C1C=Cc2cc3ccoc3c(OC/C=C(/C)CC3C=C(C)C(=O)O3)c2O1 |
| InChI | InChI=1S/C22H20O5/c1-13(10-18-11-14(2)22(23)27-18)6-8-25-21-19-17(7-9-24-19)12-16-5-4-15(3)26-20(16)21/h4-7,9,11-12,18H,3,8,10H2,1-2H3/b13-6- |
| InChIKey | RBUHWRZPEYRYPU-MLPAPPSSSA-N |
| XLogP | 4.94 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|