C27H36O5 — CID 58388328
[(3R,6E,10E)-2-hydroxy-2,6,10-trimethyl-12-(2-methylidenechromen-7-yl)oxydodeca-6,10-dien-3-yl] acetate (PubChem CID 58388328) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is [(3R,6E,10E)-2-hydroxy-2,6,10-trimethyl-12-(2-methylidenechromen-7-yl)oxydodeca-6,10-dien-3-yl] acetate.
| Compound Name | [(3R,6E,10E)-2-hydroxy-2,6,10-trimethyl-12-(2-methylidenechromen-7-yl)oxydodeca-6,10-dien-3-yl] acetate |
|---|---|
| PubChem CID | 58388328 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | [(3R,6E,10E)-2-hydroxy-2,6,10-trimethyl-12-(2-methylidenechromen-7-yl)oxydodeca-6,10-dien-3-yl] acetate |
| SMILES | C=C1C=Cc2ccc(OC/C=C(\C)CC/C=C(\C)CC[C@@H](OC(C)=O)C(C)(C)O)cc2O1 |
| InChI | InChI=1S/C27H36O5/c1-19(10-15-26(27(5,6)29)32-22(4)28)8-7-9-20(2)16-17-30-24-14-13-23-12-11-21(3)31-25(23)18-24/h8,11-14,16,18,26,29H,3,7,9-10,15,17H2,1-2,4-6H3/b19-8+,20-16+/t26-/m1/s1 |
| InChIKey | SIYBNMBZSLDEBR-YRFNIJFQSA-N |
| XLogP | 6.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|