C30H29BrN6O3S2 — CID 160587223
2-bromo-1-pyridin-4-ylethanone;N-(4-methoxyphenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine;(4-methoxyphenyl)thiourea (PubChem CID 160587223) has the molecular formula C30H29BrN6O3S2 and a molecular weight of 665.64 g/mol. Its IUPAC name is 2-bromo-1-pyridin-4-ylethanone;N-(4-methoxyphenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine;(4-methoxyphenyl)thiourea.
| Compound Name | 2-bromo-1-pyridin-4-ylethanone;N-(4-methoxyphenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine;(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 160587223 |
| Molecular Formula | C30H29BrN6O3S2 |
| Molecular Weight | 665.64 g/mol |
| Exact Mass | 664.09 |
| IUPAC Name | 2-bromo-1-pyridin-4-ylethanone;N-(4-methoxyphenyl)-4-pyridin-4-yl-1,3-thiazol-2-amine;(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(N)=S)cc1.COc1ccc(Nc2nc(-c3ccncc3)cs2)cc1.O=C(CBr)c1ccncc1 |
| InChI | InChI=1S/C15H13N3OS.C8H10N2OS.C7H6BrNO/c1-19-13-4-2-12(3-5-13)17-15-18-14(10-20-15)11-6-8-16-9-7-11;1-11-7-4-2-6(3-5-7)10-8(9)12;8-5-7(10)6-1-3-9-4-2-6/h2-10H,1H3,(H,17,18);2-5H,1H3,(H3,9,10,12);1-4H,5H2 |
| InChIKey | RCNWWXORKBGRBK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|