C25H24Br4O4 — CID 160667557
2-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-phenylpropyl]phenoxy]ethanol (PubChem CID 160667557) has the molecular formula C25H24Br4O4 and a molecular weight of 708.08 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-phenylpropyl]phenoxy]ethanol.
| Compound Name | 2-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-phenylpropyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 160667557 |
| Molecular Formula | C25H24Br4O4 |
| Molecular Weight | 708.08 g/mol |
| Exact Mass | 703.84 |
| IUPAC Name | 2-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-phenylpropyl]phenoxy]ethanol |
| SMILES | CCC(c1ccccc1)(c1cc(Br)c(OCCO)c(Br)c1)c1cc(Br)c(OCCO)c(Br)c1 |
| InChI | InChI=1S/C25H24Br4O4/c1-2-25(16-6-4-3-5-7-16,17-12-19(26)23(20(27)13-17)32-10-8-30)18-14-21(28)24(22(29)15-18)33-11-9-31/h3-7,12-15,30-31H,2,8-11H2,1H3 |
| InChIKey | RMMUUKSTAQREJF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.08 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|