C7H16O20P2S2 — CID 160734694
[(1R,4R)-3-methoxy-5-phosphonooxy-2,4-disulfooxy-6-(trioxidanyl)cyclohexyl] dihydrogen phosphate (PubChem CID 160734694) has the molecular formula C7H16O20P2S2 and a molecular weight of 546.27 g/mol. Its IUPAC name is [(1R,4R)-3-methoxy-5-phosphonooxy-2,4-disulfooxy-6-(trioxidanyl)cyclohexyl] dihydrogen phosphate.
| Compound Name | [(1R,4R)-3-methoxy-5-phosphonooxy-2,4-disulfooxy-6-(trioxidanyl)cyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 160734694 |
| Molecular Formula | C7H16O20P2S2 |
| Molecular Weight | 546.27 g/mol |
| Exact Mass | 545.92 |
| IUPAC Name | [(1R,4R)-3-methoxy-5-phosphonooxy-2,4-disulfooxy-6-(trioxidanyl)cyclohexyl] dihydrogen phosphate |
| SMILES | COC1C(OS(=O)(=O)O)[C@H](OP(=O)(O)O)C(OOO)C(OP(=O)(O)O)[C@@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C7H16O20P2S2/c1-21-2-6(25-30(15,16)17)4(23-28(9,10)11)3(22-27-8)5(24-29(12,13)14)7(2)26-31(18,19)20/h2-8H,1H3,(H2,9,10,11)(H2,12,13,14)(H,15,16,17)(H,18,19,20)/t2?,3?,4-,5?,6?,7-/m1/s1 |
| InChIKey | WRDWPODFGSOLQH-ARCLJIFYSA-N |
| XLogP | -2.86 |
| TPSA | 308.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.27 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|