C11H22N2P+ — CID 160796828
[3,6-bis(dimethylamino)-1-methylcyclohexa-2,4-dien-1-yl]phosphanium (PubChem CID 160796828) has the molecular formula C11H22N2P+ and a molecular weight of 213.28 g/mol. Its IUPAC name is [3,6-bis(dimethylamino)-1-methylcyclohexa-2,4-dien-1-yl]phosphanium.
| Compound Name | [3,6-bis(dimethylamino)-1-methylcyclohexa-2,4-dien-1-yl]phosphanium |
|---|---|
| PubChem CID | 160796828 |
| Molecular Formula | C11H22N2P+ |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | [3,6-bis(dimethylamino)-1-methylcyclohexa-2,4-dien-1-yl]phosphanium |
| SMILES | CN(C)C1=CC(C)([PH3+])C(N(C)C)C=C1 |
| InChI | InChI=1S/C11H21N2P/c1-11(14)8-9(12(2)3)6-7-10(11)13(4)5/h6-8,10H,14H2,1-5H3/p+1 |
| InChIKey | OOKZKDYFNFVUHY-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|