About 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate
1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate (PubChem CID 160801793) has the molecular formula C13H25O9P
and a molecular weight of 356.31 g/mol. Its IUPAC name is 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate.
Molecular Properties
| Compound Name | 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate |
| PubChem CID | 160801793 |
| Molecular Formula | C13H25O9P |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate |
| SMILES | CC(=O)OC(C)OP(=O)(OC(C)OC(=O)O)OC(C)(C)C(C)C |
| InChI | InChI=1S/C13H25O9P/c1-8(2)13(6,7)22-23(17,20-10(4)18-9(3)14)21-11(5)19-12(15)16/h8,10-11H,1-7H3,(H,15,16) |
| InChIKey | XIBNYXSMYBGNND-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate?
The IUPAC name of 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate (CID 160801793) is 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate.
What is the SMILES notation for 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate?
The canonical SMILES for 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate is CC(=O)OC(C)OP(=O)(OC(C)OC(=O)O)OC(C)(C)C(C)C.
What is the InChIKey of 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate?
The InChIKey is XIBNYXSMYBGNND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25O9P/c1-8(2)13(6,7)22-23(17,20-10(4)18-9(3)14)21-11(5)19-12(15)16/h8,10-11H,1-7H3,(H,15,16).
What are the key properties of 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate?
1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate has a molecular weight of 356.31 g/mol, XLogP of 3.53, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate is sourced from PubChem (CID 160801793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).