C13H25O9P — CID 160801793
1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate (PubChem CID 160801793) has the molecular formula C13H25O9P and a molecular weight of 356.31 g/mol. Its IUPAC name is 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate.
| Compound Name | 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate |
|---|---|
| PubChem CID | 160801793 |
| Molecular Formula | C13H25O9P |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[1-carboxyoxyethoxy(2,3-dimethylbutan-2-yloxy)phosphoryl]oxyethyl acetate |
| SMILES | CC(=O)OC(C)OP(=O)(OC(C)OC(=O)O)OC(C)(C)C(C)C |
| InChI | InChI=1S/C13H25O9P/c1-8(2)13(6,7)22-23(17,20-10(4)18-9(3)14)21-11(5)19-12(15)16/h8,10-11H,1-7H3,(H,15,16) |
| InChIKey | XIBNYXSMYBGNND-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|