C31H49NO11 — CID 160887246
[(2R,3S,4R,5R,6R)-3-acetyloxy-6-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxy-4,5-dimethyloxan-2-yl]methyl 4-cyano-2,2,4-trimethylpentanoate (PubChem CID 160887246) has the molecular formula C31H49NO11 and a molecular weight of 611.73 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3-acetyloxy-6-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxy-4,5-dimethyloxan-2-yl]methyl 4-cyano-2,2,4-trimethylpentanoate.
| Compound Name | [(2R,3S,4R,5R,6R)-3-acetyloxy-6-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxy-4,5-dimethyloxan-2-yl]methyl 4-cyano-2,2,4-trimethylpentanoate |
|---|---|
| PubChem CID | 160887246 |
| Molecular Formula | C31H49NO11 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3-acetyloxy-6-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxy-4,5-dimethyloxan-2-yl]methyl 4-cyano-2,2,4-trimethylpentanoate |
| SMILES | CC[C@H]1O[C@H](O[C@H]2O[C@H](COC(=O)C(C)(C)CC(C)(C)C#N)[C@@H](OC(C)=O)[C@H](C)[C@H]2C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C31H49NO11/c1-12-22-18(4)25(39-20(6)34)26(40-21(7)35)28(41-22)43-27-17(3)16(2)24(38-19(5)33)23(42-27)13-37-29(36)31(10,11)14-30(8,9)15-32/h16-18,22-28H,12-14H2,1-11H3/t16-,17-,18-,22-,23-,24+,25+,26-,27-,28-/m1/s1 |
| InChIKey | DXDQVZCVCDWQRZ-ZZMJGWOXSA-N |
| XLogP | 4.08 |
| TPSA | 156.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|