C55H58N2O5 — CID 160889604
2,4-ditert-butyl-6-[[2-(4-dibenzofuran-4-yl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol;3,5-ditert-butyl-2-hydroxybenzaldehyde (PubChem CID 160889604) has the molecular formula C55H58N2O5 and a molecular weight of 827.08 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-(4-dibenzofuran-4-yl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol;3,5-ditert-butyl-2-hydroxybenzaldehyde.
| Compound Name | 2,4-ditert-butyl-6-[[2-(4-dibenzofuran-4-yl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol;3,5-ditert-butyl-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 160889604 |
| Molecular Formula | C55H58N2O5 |
| Molecular Weight | 827.08 g/mol |
| Exact Mass | 826.43 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-(4-dibenzofuran-4-yl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol;3,5-ditert-butyl-2-hydroxybenzaldehyde |
| SMILES | CC(C)(C)c1cc(/C=N\c2ccccc2-c2nc3c(-c4cccc5c4oc4ccccc45)cccc3o2)c(O)c(C(C)(C)C)c1.CC(C)(C)c1cc(C=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H36N2O3.C15H22O2/c1-39(2,3)25-21-24(36(43)31(22-25)40(4,5)6)23-41-32-18-9-7-14-30(32)38-42-35-27(15-12-20-34(35)45-38)29-17-11-16-28-26-13-8-10-19-33(26)44-37(28)29;1-14(2,3)11-7-10(9-16)13(17)12(8-11)15(4,5)6/h7-23,43H,1-6H3;7-9,17H,1-6H3/b41-23-; |
| InChIKey | SOBYYQILRWGNCY-DKOFRRIHSA-N |
| XLogP | 14.91 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.08 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|