C33H54O8 — CID 160891868
(1-acetyl-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl) acetate;methyl (2S)-3-[(1R)-1-(4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)ethoxy]-2-methylpropanoate (PubChem CID 160891868) has the molecular formula C33H54O8 and a molecular weight of 578.79 g/mol. Its IUPAC name is (1-acetyl-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl) acetate;methyl (2S)-3-[(1R)-1-(4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)ethoxy]-2-methylpropanoate.
| Compound Name | (1-acetyl-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl) acetate;methyl (2S)-3-[(1R)-1-(4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)ethoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 160891868 |
| Molecular Formula | C33H54O8 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.38 |
| IUPAC Name | (1-acetyl-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl) acetate;methyl (2S)-3-[(1R)-1-(4-acetyloxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl)ethoxy]-2-methylpropanoate |
| SMILES | CC(=O)OC1CCCC2(C)C(C(C)=O)CCC12.COC(=O)[C@@H](C)CO[C@H](C)C1CCC2C(OC(C)=O)CCCC21C |
| InChI | InChI=1S/C19H32O5.C14H22O3/c1-12(18(21)22-5)11-23-13(2)15-8-9-16-17(24-14(3)20)7-6-10-19(15,16)4;1-9(15)11-6-7-12-13(17-10(2)16)5-4-8-14(11,12)3/h12-13,15-17H,6-11H2,1-5H3;11-13H,4-8H2,1-3H3/t12-,13+,15?,16?,17?,19?;/m0./s1 |
| InChIKey | SOJKRSPGMATETE-QCZPFYQHSA-N |
| XLogP | 6.07 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|